About 1-(3-chloroanilino)-3-(3,6-dichlorocarbazol-9-yl)propan-2-ol
1-(3-chloroanilino)-3-(3,6-dichlorocarbazol-9-yl)propan-2-ol (PubChem CID 3103959) has the molecular formula C21H17Cl3N2O
and a molecular weight of 419.74 g/mol. Its IUPAC name is 1-(3-chloroanilino)-3-(3,6-dichlorocarbazol-9-yl)propan-2-ol.
Molecular Properties
| Compound Name | 1-(3-chloroanilino)-3-(3,6-dichlorocarbazol-9-yl)propan-2-ol |
| PubChem CID | 3103959 |
| Molecular Formula | C21H17Cl3N2O |
| Molecular Weight | 419.74 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 1-(3-chloroanilino)-3-(3,6-dichlorocarbazol-9-yl)propan-2-ol |
| SMILES | OC(CNc1cccc(Cl)c1)Cn1c2ccc(Cl)cc2c2cc(Cl)ccc21 |
| InChI | InChI=1S/C21H17Cl3N2O/c22-13-2-1-3-16(8-13)25-11-17(27)12-26-20-6-4-14(23)9-18(20)19-10-15(24)5-7-21(19)26/h1-10,17,25,27H,11-12H2 |
| InChIKey | FUHPNRVLZBWEGK-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.74 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-chloroanilino)-3-(3,6-dichlorocarbazol-9-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloroanilino)-3-(3,6-dichlorocarbazol-9-yl)propan-2-ol?
The IUPAC name of 1-(3-chloroanilino)-3-(3,6-dichlorocarbazol-9-yl)propan-2-ol (CID 3103959) is 1-(3-chloroanilino)-3-(3,6-dichlorocarbazol-9-yl)propan-2-ol.
What is the SMILES notation for 1-(3-chloroanilino)-3-(3,6-dichlorocarbazol-9-yl)propan-2-ol?
The canonical SMILES for 1-(3-chloroanilino)-3-(3,6-dichlorocarbazol-9-yl)propan-2-ol is OC(CNc1cccc(Cl)c1)Cn1c2ccc(Cl)cc2c2cc(Cl)ccc21.
What is the InChIKey of 1-(3-chloroanilino)-3-(3,6-dichlorocarbazol-9-yl)propan-2-ol?
The InChIKey is FUHPNRVLZBWEGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17Cl3N2O/c22-13-2-1-3-16(8-13)25-11-17(27)12-26-20-6-4-14(23)9-18(20)19-10-15(24)5-7-21(19)26/h1-10,17,25,27H,11-12H2.
What are the key properties of 1-(3-chloroanilino)-3-(3,6-dichlorocarbazol-9-yl)propan-2-ol?
1-(3-chloroanilino)-3-(3,6-dichlorocarbazol-9-yl)propan-2-ol has a molecular weight of 419.74 g/mol, XLogP of 6.23, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloroanilino)-3-(3,6-dichlorocarbazol-9-yl)propan-2-ol is sourced from PubChem (CID 3103959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).