C27H24F3NO9S3 — CID 3103990
tetramethyl 5',5',8'-trimethyl-6'-(2,2,2-trifluoroacetyl)spiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate (PubChem CID 3103990) has the molecular formula C27H24F3NO9S3 and a molecular weight of 659.68 g/mol. Its IUPAC name is tetramethyl 5',5',8'-trimethyl-6'-(2,2,2-trifluoroacetyl)spiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate.
| Compound Name | tetramethyl 5',5',8'-trimethyl-6'-(2,2,2-trifluoroacetyl)spiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate |
|---|---|
| PubChem CID | 3103990 |
| Molecular Formula | C27H24F3NO9S3 |
| Molecular Weight | 659.68 g/mol |
| Exact Mass | 659.06 |
| IUPAC Name | tetramethyl 5',5',8'-trimethyl-6'-(2,2,2-trifluoroacetyl)spiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC2(S1)C(C(=O)OC)=C(C(=O)OC)SC1=C2c2ccc(C)cc2N(C(=O)C(F)(F)F)C1(C)C |
| InChI | InChI=1S/C27H24F3NO9S3/c1-11-8-9-12-13(10-11)31(24(36)27(28,29)30)25(2,3)19-14(12)26(15(20(32)37-4)16(41-19)21(33)38-5)42-17(22(34)39-6)18(43-26)23(35)40-7/h8-10H,1-7H3 |
| InChIKey | SOLHGVJNDCNMGU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.68 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|