C23H29FN2O — CID 31043895
1-[4-(3-fluorophenyl)phenyl]-4-[(3S)-3-(methoxymethyl)pyrrolidin-1-yl]piperidine (PubChem CID 31043895) has the molecular formula C23H29FN2O and a molecular weight of 368.50 g/mol. Its IUPAC name is 1-[4-(3-fluorophenyl)phenyl]-4-[(3S)-3-(methoxymethyl)pyrrolidin-1-yl]piperidine.
| Compound Name | 1-[4-(3-fluorophenyl)phenyl]-4-[(3S)-3-(methoxymethyl)pyrrolidin-1-yl]piperidine |
|---|---|
| PubChem CID | 31043895 |
| Molecular Formula | C23H29FN2O |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 1-[4-(3-fluorophenyl)phenyl]-4-[(3S)-3-(methoxymethyl)pyrrolidin-1-yl]piperidine |
| SMILES | COC[C@H]1CCN(C2CCN(c3ccc(-c4cccc(F)c4)cc3)CC2)C1 |
| InChI | InChI=1S/C23H29FN2O/c1-27-17-18-9-12-26(16-18)23-10-13-25(14-11-23)22-7-5-19(6-8-22)20-3-2-4-21(24)15-20/h2-8,15,18,23H,9-14,16-17H2,1H3/t18-/m0/s1 |
| InChIKey | BKUSOFIBDHPRJN-SFHVURJKSA-N |
| XLogP | 4.43 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |