C22H36N2O10 — CID 3104532
diethyl 2-[[4-[(1,5-diethoxy-1,5-dioxopentan-2-yl)amino]-4-oxobutanoyl]amino]pentanedioate (PubChem CID 3104532) has the molecular formula C22H36N2O10 and a molecular weight of 488.53 g/mol. Its IUPAC name is diethyl 2-[[4-[(1,5-diethoxy-1,5-dioxopentan-2-yl)amino]-4-oxobutanoyl]amino]pentanedioate.
| Compound Name | diethyl 2-[[4-[(1,5-diethoxy-1,5-dioxopentan-2-yl)amino]-4-oxobutanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 3104532 |
| Molecular Formula | C22H36N2O10 |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | diethyl 2-[[4-[(1,5-diethoxy-1,5-dioxopentan-2-yl)amino]-4-oxobutanoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CCC(NC(=O)CCC(=O)NC(CCC(=O)OCC)C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C22H36N2O10/c1-5-31-19(27)13-9-15(21(29)33-7-3)23-17(25)11-12-18(26)24-16(22(30)34-8-4)10-14-20(28)32-6-2/h15-16H,5-14H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | AVFOBBZBBCVOHQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|