C24H40N2O10 — CID 3104534
diethyl 2-[[6-[(1,5-diethoxy-1,5-dioxopentan-2-yl)amino]-6-oxohexanoyl]amino]pentanedioate (PubChem CID 3104534) has the molecular formula C24H40N2O10 and a molecular weight of 516.59 g/mol. Its IUPAC name is diethyl 2-[[6-[(1,5-diethoxy-1,5-dioxopentan-2-yl)amino]-6-oxohexanoyl]amino]pentanedioate.
| Compound Name | diethyl 2-[[6-[(1,5-diethoxy-1,5-dioxopentan-2-yl)amino]-6-oxohexanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 3104534 |
| Molecular Formula | C24H40N2O10 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | diethyl 2-[[6-[(1,5-diethoxy-1,5-dioxopentan-2-yl)amino]-6-oxohexanoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CCC(NC(=O)CCCCC(=O)NC(CCC(=O)OCC)C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C24H40N2O10/c1-5-33-21(29)15-13-17(23(31)35-7-3)25-19(27)11-9-10-12-20(28)26-18(24(32)36-8-4)14-16-22(30)34-6-2/h17-18H,5-16H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | MAOXMQLAZLLHCM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|