C23H24N2O2 — CID 3104582
2-N,3-N-bis(3-methylphenyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide (PubChem CID 3104582) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-N,3-N-bis(3-methylphenyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide.
| Compound Name | 2-N,3-N-bis(3-methylphenyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
|---|---|
| PubChem CID | 3104582 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-N,3-N-bis(3-methylphenyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)C2C3C=CC(C3)C2C(=O)Nc2cccc(C)c2)c1 |
| InChI | InChI=1S/C23H24N2O2/c1-14-5-3-7-18(11-14)24-22(26)20-16-9-10-17(13-16)21(20)23(27)25-19-8-4-6-15(2)12-19/h3-12,16-17,20-21H,13H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | SHWKPSRQAGMRCR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|