About 5-nitro-3,4-diphenylhexan-2-one
5-nitro-3,4-diphenylhexan-2-one (PubChem CID 3104620) has the molecular formula C18H19NO3
and a molecular weight of 297.35 g/mol. Its IUPAC name is 5-nitro-3,4-diphenylhexan-2-one.
Molecular Properties
| Compound Name | 5-nitro-3,4-diphenylhexan-2-one |
| PubChem CID | 3104620 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 5-nitro-3,4-diphenylhexan-2-one |
| SMILES | CC(=O)C(c1ccccc1)C(c1ccccc1)C(C)[N+](=O)[O-] |
| InChI | InChI=1S/C18H19NO3/c1-13(19(21)22)17(15-9-5-3-6-10-15)18(14(2)20)16-11-7-4-8-12-16/h3-13,17-18H,1-2H3 |
| InChIKey | JMJGTAJCIPQMSZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-3,4-diphenylhexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-3,4-diphenylhexan-2-one?
The IUPAC name of 5-nitro-3,4-diphenylhexan-2-one (CID 3104620) is 5-nitro-3,4-diphenylhexan-2-one.
What is the SMILES notation for 5-nitro-3,4-diphenylhexan-2-one?
The canonical SMILES for 5-nitro-3,4-diphenylhexan-2-one is CC(=O)C(c1ccccc1)C(c1ccccc1)C(C)[N+](=O)[O-].
What is the InChIKey of 5-nitro-3,4-diphenylhexan-2-one?
The InChIKey is JMJGTAJCIPQMSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3/c1-13(19(21)22)17(15-9-5-3-6-10-15)18(14(2)20)16-11-7-4-8-12-16/h3-13,17-18H,1-2H3.
What are the key properties of 5-nitro-3,4-diphenylhexan-2-one?
5-nitro-3,4-diphenylhexan-2-one has a molecular weight of 297.35 g/mol, XLogP of 3.81, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-3,4-diphenylhexan-2-one is sourced from PubChem (CID 3104620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).