C12H10N4O2 — CID 31048059
3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]quinazolin-4-one (PubChem CID 31048059) has the molecular formula C12H10N4O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]quinazolin-4-one.
| Compound Name | 3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 31048059 |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]quinazolin-4-one |
| SMILES | Cc1noc(Cn2cnc3ccccc3c2=O)n1 |
| InChI | InChI=1S/C12H10N4O2/c1-8-14-11(18-15-8)6-16-7-13-10-5-3-2-4-9(10)12(16)17/h2-5,7H,6H2,1H3 |
| InChIKey | JFZJKYXWAJHXQD-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |