About N-butyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide
N-butyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide (PubChem CID 3104807) has the molecular formula C10H15N5O5
and a molecular weight of 285.26 g/mol. Its IUPAC name is N-butyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-butyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide |
| PubChem CID | 3104807 |
| Molecular Formula | C10H15N5O5 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | N-butyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide |
| SMILES | CCCCNC(=O)Cn1nc([N+](=O)[O-])c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C10H15N5O5/c1-3-4-5-11-8(16)6-13-7(2)9(14(17)18)10(12-13)15(19)20/h3-6H2,1-2H3,(H,11,16) |
| InChIKey | SPROQOXYQNCXKC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide?
The IUPAC name of N-butyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide (CID 3104807) is N-butyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide.
What is the SMILES notation for N-butyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide?
The canonical SMILES for N-butyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide is CCCCNC(=O)Cn1nc([N+](=O)[O-])c([N+](=O)[O-])c1C.
What is the InChIKey of N-butyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide?
The InChIKey is SPROQOXYQNCXKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5O5/c1-3-4-5-11-8(16)6-13-7(2)9(14(17)18)10(12-13)15(19)20/h3-6H2,1-2H3,(H,11,16).
What are the key properties of N-butyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide?
N-butyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide has a molecular weight of 285.26 g/mol, XLogP of 0.92, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide is sourced from PubChem (CID 3104807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).