About N-benzyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide
N-benzyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide (PubChem CID 3104808) has the molecular formula C13H13N5O5
and a molecular weight of 319.28 g/mol. Its IUPAC name is N-benzyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-benzyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide |
| PubChem CID | 3104808 |
| Molecular Formula | C13H13N5O5 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | N-benzyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide |
| SMILES | Cc1c([N+](=O)[O-])c([N+](=O)[O-])nn1CC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C13H13N5O5/c1-9-12(17(20)21)13(18(22)23)15-16(9)8-11(19)14-7-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H,14,19) |
| InChIKey | UVQMIRFOZADXON-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide?
The IUPAC name of N-benzyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide (CID 3104808) is N-benzyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide.
What is the SMILES notation for N-benzyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide?
The canonical SMILES for N-benzyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide is Cc1c([N+](=O)[O-])c([N+](=O)[O-])nn1CC(=O)NCc1ccccc1.
What is the InChIKey of N-benzyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide?
The InChIKey is UVQMIRFOZADXON-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N5O5/c1-9-12(17(20)21)13(18(22)23)15-16(9)8-11(19)14-7-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H,14,19).
What are the key properties of N-benzyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide?
N-benzyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide has a molecular weight of 319.28 g/mol, XLogP of 1.32, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide is sourced from PubChem (CID 3104808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).