About N-butyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide
N-butyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide (PubChem CID 3104818) has the molecular formula C8H13N5O3
and a molecular weight of 227.22 g/mol. Its IUPAC name is N-butyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-butyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| PubChem CID | 3104818 |
| Molecular Formula | C8H13N5O3 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | N-butyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| SMILES | CCCCNC(=O)Cn1cnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C8H13N5O3/c1-2-3-4-9-7(14)5-12-6-10-8(11-12)13(15)16/h6H,2-5H2,1H3,(H,9,14) |
| InChIKey | WUBNTGPRUNECAV-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide?
The IUPAC name of N-butyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide (CID 3104818) is N-butyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide.
What is the SMILES notation for N-butyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide?
The canonical SMILES for N-butyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide is CCCCNC(=O)Cn1cnc([N+](=O)[O-])n1.
What is the InChIKey of N-butyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide?
The InChIKey is WUBNTGPRUNECAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N5O3/c1-2-3-4-9-7(14)5-12-6-10-8(11-12)13(15)16/h6H,2-5H2,1H3,(H,9,14).
What are the key properties of N-butyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide?
N-butyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide has a molecular weight of 227.22 g/mol, XLogP of 0.10, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide is sourced from PubChem (CID 3104818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).