About methyl 6-carbamoyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate
methyl 6-carbamoyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate (PubChem CID 3105252) has the molecular formula C17H22N2O7S2
and a molecular weight of 430.50 g/mol. Its IUPAC name is methyl 6-carbamoyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-carbamoyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate |
| PubChem CID | 3105252 |
| Molecular Formula | C17H22N2O7S2 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | methyl 6-carbamoyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate |
| SMILES | CCCS(=O)(=O)c1c(S(=O)(=O)CCC)c2ccc(C(N)=O)cn2c1C(=O)OC |
| InChI | InChI=1S/C17H22N2O7S2/c1-4-8-27(22,23)14-12-7-6-11(16(18)20)10-19(12)13(17(21)26-3)15(14)28(24,25)9-5-2/h6-7,10H,4-5,8-9H2,1-3H3,(H2,18,20) |
| InChIKey | KAXAXEQWUINVII-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 142.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 6-carbamoyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-carbamoyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate?
The IUPAC name of methyl 6-carbamoyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate (CID 3105252) is methyl 6-carbamoyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate.
What is the SMILES notation for methyl 6-carbamoyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate?
The canonical SMILES for methyl 6-carbamoyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate is CCCS(=O)(=O)c1c(S(=O)(=O)CCC)c2ccc(C(N)=O)cn2c1C(=O)OC.
What is the InChIKey of methyl 6-carbamoyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate?
The InChIKey is KAXAXEQWUINVII-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O7S2/c1-4-8-27(22,23)14-12-7-6-11(16(18)20)10-19(12)13(17(21)26-3)15(14)28(24,25)9-5-2/h6-7,10H,4-5,8-9H2,1-3H3,(H2,18,20).
What are the key properties of methyl 6-carbamoyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate?
methyl 6-carbamoyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate has a molecular weight of 430.50 g/mol, XLogP of 1.19, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-carbamoyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate is sourced from PubChem (CID 3105252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).