About [3,4,5-triacetyloxy-6-(2-ethylsulfonylethylsulfanyl)oxan-2-yl]methyl acetate
[3,4,5-triacetyloxy-6-(2-ethylsulfonylethylsulfanyl)oxan-2-yl]methyl acetate (PubChem CID 3105259) has the molecular formula C18H28O11S2
and a molecular weight of 484.55 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-(2-ethylsulfonylethylsulfanyl)oxan-2-yl]methyl acetate.
Molecular Properties
| Compound Name | [3,4,5-triacetyloxy-6-(2-ethylsulfonylethylsulfanyl)oxan-2-yl]methyl acetate |
| PubChem CID | 3105259 |
| Molecular Formula | C18H28O11S2 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | [3,4,5-triacetyloxy-6-(2-ethylsulfonylethylsulfanyl)oxan-2-yl]methyl acetate |
| SMILES | CCS(=O)(=O)CCSC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C18H28O11S2/c1-6-31(23,24)8-7-30-18-17(28-13(5)22)16(27-12(4)21)15(26-11(3)20)14(29-18)9-25-10(2)19/h14-18H,6-9H2,1-5H3 |
| InChIKey | AGYBQBUPPJQKDM-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [3,4,5-triacetyloxy-6-(2-ethylsulfonylethylsulfanyl)oxan-2-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,4,5-triacetyloxy-6-(2-ethylsulfonylethylsulfanyl)oxan-2-yl]methyl acetate?
The IUPAC name of [3,4,5-triacetyloxy-6-(2-ethylsulfonylethylsulfanyl)oxan-2-yl]methyl acetate (CID 3105259) is [3,4,5-triacetyloxy-6-(2-ethylsulfonylethylsulfanyl)oxan-2-yl]methyl acetate.
What is the SMILES notation for [3,4,5-triacetyloxy-6-(2-ethylsulfonylethylsulfanyl)oxan-2-yl]methyl acetate?
The canonical SMILES for [3,4,5-triacetyloxy-6-(2-ethylsulfonylethylsulfanyl)oxan-2-yl]methyl acetate is CCS(=O)(=O)CCSC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O.
What is the InChIKey of [3,4,5-triacetyloxy-6-(2-ethylsulfonylethylsulfanyl)oxan-2-yl]methyl acetate?
The InChIKey is AGYBQBUPPJQKDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O11S2/c1-6-31(23,24)8-7-30-18-17(28-13(5)22)16(27-12(4)21)15(26-11(3)20)14(29-18)9-25-10(2)19/h14-18H,6-9H2,1-5H3.
What are the key properties of [3,4,5-triacetyloxy-6-(2-ethylsulfonylethylsulfanyl)oxan-2-yl]methyl acetate?
[3,4,5-triacetyloxy-6-(2-ethylsulfonylethylsulfanyl)oxan-2-yl]methyl acetate has a molecular weight of 484.55 g/mol, XLogP of 0.24, 10 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for [3,4,5-triacetyloxy-6-(2-ethylsulfonylethylsulfanyl)oxan-2-yl]methyl acetate is sourced from PubChem (CID 3105259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).