C19H17N3O4 — CID 31054972
N-(3,4,5-trimethoxyphenyl)-[1]benzofuro[3,2-d]pyrimidin-4-amine (PubChem CID 31054972) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is N-(3,4,5-trimethoxyphenyl)-[1]benzofuro[3,2-d]pyrimidin-4-amine.
| Compound Name | N-(3,4,5-trimethoxyphenyl)-[1]benzofuro[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 31054972 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N-(3,4,5-trimethoxyphenyl)-[1]benzofuro[3,2-d]pyrimidin-4-amine |
| SMILES | COc1cc(Nc2ncnc3c2oc2ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C19H17N3O4/c1-23-14-8-11(9-15(24-2)17(14)25-3)22-19-18-16(20-10-21-19)12-6-4-5-7-13(12)26-18/h4-10H,1-3H3,(H,20,21,22) |
| InChIKey | JNQABVPHBBPURE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |