C20H38N4O4 — CID 3106269
N,N'-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxamide (PubChem CID 3106269) has the molecular formula C20H38N4O4 and a molecular weight of 398.55 g/mol. Its IUPAC name is N,N'-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxamide.
| Compound Name | N,N'-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 3106269 |
| Molecular Formula | C20H38N4O4 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | N,N'-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
| SMILES | CC1(C)CC(NC(=O)C(=O)NC2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1O |
| InChI | InChI=1S/C20H38N4O4/c1-17(2)9-13(10-18(3,4)23(17)27)21-15(25)16(26)22-14-11-19(5,6)24(28)20(7,8)12-14/h13-14,27-28H,9-12H2,1-8H3,(H,21,25)(H,22,26) |
| InChIKey | YABCJWQXHUADGD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|