C11H5N7O10 — CID 3106274
3,5-dinitro-N-(2,4,6-trinitrophenyl)pyridin-2-amine (PubChem CID 3106274) has the molecular formula C11H5N7O10 and a molecular weight of 395.20 g/mol. Its IUPAC name is 3,5-dinitro-N-(2,4,6-trinitrophenyl)pyridin-2-amine.
| Compound Name | 3,5-dinitro-N-(2,4,6-trinitrophenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 3106274 |
| Molecular Formula | C11H5N7O10 |
| Molecular Weight | 395.20 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | 3,5-dinitro-N-(2,4,6-trinitrophenyl)pyridin-2-amine |
| SMILES | O=[N+]([O-])c1cnc(Nc2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H5N7O10/c19-14(20)5-1-7(16(23)24)10(8(2-5)17(25)26)13-11-9(18(27)28)3-6(4-12-11)15(21)22/h1-4H,(H,12,13) |
| InChIKey | YNCRJDVIFSGCTH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 240.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|