About 5,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyrimidine-2-thione
5,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyrimidine-2-thione (PubChem CID 3106651) has the molecular formula C12H14N2S
and a molecular weight of 218.33 g/mol. Its IUPAC name is 5,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyrimidine-2-thione.
Molecular Properties
| Compound Name | 5,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyrimidine-2-thione |
| PubChem CID | 3106651 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.33 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 5,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyrimidine-2-thione |
| SMILES | CC1=C(C)C(c2ccccc2)NC(=S)N1 |
| InChI | InChI=1S/C12H14N2S/c1-8-9(2)13-12(15)14-11(8)10-6-4-3-5-7-10/h3-7,11H,1-2H3,(H2,13,14,15) |
| InChIKey | LVLSWQUSHVNHNB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyrimidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyrimidine-2-thione?
The IUPAC name of 5,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyrimidine-2-thione (CID 3106651) is 5,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyrimidine-2-thione.
What is the SMILES notation for 5,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyrimidine-2-thione?
The canonical SMILES for 5,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyrimidine-2-thione is CC1=C(C)C(c2ccccc2)NC(=S)N1.
What is the InChIKey of 5,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyrimidine-2-thione?
The InChIKey is LVLSWQUSHVNHNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2S/c1-8-9(2)13-12(15)14-11(8)10-6-4-3-5-7-10/h3-7,11H,1-2H3,(H2,13,14,15).
What are the key properties of 5,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyrimidine-2-thione?
5,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyrimidine-2-thione has a molecular weight of 218.33 g/mol, XLogP of 2.50, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyrimidine-2-thione is sourced from PubChem (CID 3106651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).