C19H22F2N2O2 — CID 31066601
1-[(1S)-1-(3,4-difluorophenyl)ethyl]-1-methyl-3-[2-(3-methylphenoxy)ethyl]urea (PubChem CID 31066601) has the molecular formula C19H22F2N2O2 and a molecular weight of 348.39 g/mol. Its IUPAC name is 1-[(1S)-1-(3,4-difluorophenyl)ethyl]-1-methyl-3-[2-(3-methylphenoxy)ethyl]urea.
| Compound Name | 1-[(1S)-1-(3,4-difluorophenyl)ethyl]-1-methyl-3-[2-(3-methylphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 31066601 |
| Molecular Formula | C19H22F2N2O2 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-[(1S)-1-(3,4-difluorophenyl)ethyl]-1-methyl-3-[2-(3-methylphenoxy)ethyl]urea |
| SMILES | Cc1cccc(OCCNC(=O)N(C)[C@@H](C)c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C19H22F2N2O2/c1-13-5-4-6-16(11-13)25-10-9-22-19(24)23(3)14(2)15-7-8-17(20)18(21)12-15/h4-8,11-12,14H,9-10H2,1-3H3,(H,22,24)/t14-/m0/s1 |
| InChIKey | OSUPTKFIMQEOGQ-AWEZNQCLSA-N |
| XLogP | 4.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|