C29H18Br2O — CID 3106868
3,4-bis(4-bromophenyl)-2,5-diphenylcyclopenta-2,4-dien-1-one (PubChem CID 3106868) has the molecular formula C29H18Br2O and a molecular weight of 542.27 g/mol. Its IUPAC name is 3,4-bis(4-bromophenyl)-2,5-diphenylcyclopenta-2,4-dien-1-one.
| Compound Name | 3,4-bis(4-bromophenyl)-2,5-diphenylcyclopenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 3106868 |
| Molecular Formula | C29H18Br2O |
| Molecular Weight | 542.27 g/mol |
| Exact Mass | 539.97 |
| IUPAC Name | 3,4-bis(4-bromophenyl)-2,5-diphenylcyclopenta-2,4-dien-1-one |
| SMILES | O=C1C(c2ccccc2)=C(c2ccc(Br)cc2)C(c2ccc(Br)cc2)=C1c1ccccc1 |
| InChI | InChI=1S/C29H18Br2O/c30-23-15-11-21(12-16-23)25-26(22-13-17-24(31)18-14-22)28(20-9-5-2-6-10-20)29(32)27(25)19-7-3-1-4-8-19/h1-18H |
| InChIKey | RKOFTAKXMIWIFS-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.27 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|