About 4-[4,5-bis(3-iodophenyl)-1H-imidazol-2-yl]-N,N-dimethylaniline
4-[4,5-bis(3-iodophenyl)-1H-imidazol-2-yl]-N,N-dimethylaniline (PubChem CID 3106878) has the molecular formula C23H19I2N3
and a molecular weight of 591.23 g/mol. Its IUPAC name is 4-[4,5-bis(3-iodophenyl)-1H-imidazol-2-yl]-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-[4,5-bis(3-iodophenyl)-1H-imidazol-2-yl]-N,N-dimethylaniline |
| PubChem CID | 3106878 |
| Molecular Formula | C23H19I2N3 |
| Molecular Weight | 591.23 g/mol |
| Exact Mass | 590.97 |
| IUPAC Name | 4-[4,5-bis(3-iodophenyl)-1H-imidazol-2-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2nc(-c3cccc(I)c3)c(-c3cccc(I)c3)[nH]2)cc1 |
| InChI | InChI=1S/C23H19I2N3/c1-28(2)20-11-9-15(10-12-20)23-26-21(16-5-3-7-18(24)13-16)22(27-23)17-6-4-8-19(25)14-17/h3-14H,1-2H3,(H,26,27) |
| InChIKey | WVFLCFCWYOBVBV-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 591.23 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-[4,5-bis(3-iodophenyl)-1H-imidazol-2-yl]-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4,5-bis(3-iodophenyl)-1H-imidazol-2-yl]-N,N-dimethylaniline?
The IUPAC name of 4-[4,5-bis(3-iodophenyl)-1H-imidazol-2-yl]-N,N-dimethylaniline (CID 3106878) is 4-[4,5-bis(3-iodophenyl)-1H-imidazol-2-yl]-N,N-dimethylaniline.
What is the SMILES notation for 4-[4,5-bis(3-iodophenyl)-1H-imidazol-2-yl]-N,N-dimethylaniline?
The canonical SMILES for 4-[4,5-bis(3-iodophenyl)-1H-imidazol-2-yl]-N,N-dimethylaniline is CN(C)c1ccc(-c2nc(-c3cccc(I)c3)c(-c3cccc(I)c3)[nH]2)cc1.
What is the InChIKey of 4-[4,5-bis(3-iodophenyl)-1H-imidazol-2-yl]-N,N-dimethylaniline?
The InChIKey is WVFLCFCWYOBVBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19I2N3/c1-28(2)20-11-9-15(10-12-20)23-26-21(16-5-3-7-18(24)13-16)22(27-23)17-6-4-8-19(25)14-17/h3-14H,1-2H3,(H,26,27).
What are the key properties of 4-[4,5-bis(3-iodophenyl)-1H-imidazol-2-yl]-N,N-dimethylaniline?
4-[4,5-bis(3-iodophenyl)-1H-imidazol-2-yl]-N,N-dimethylaniline has a molecular weight of 591.23 g/mol, XLogP of 6.69, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4,5-bis(3-iodophenyl)-1H-imidazol-2-yl]-N,N-dimethylaniline is sourced from PubChem (CID 3106878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).