C14H9Cl2NO2 — CID 3107223
2-(2,4-dichlorophenyl)-2,3-dihydro-1,3-benzoxazin-4-one (PubChem CID 3107223) has the molecular formula C14H9Cl2NO2 and a molecular weight of 294.14 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-2,3-dihydro-1,3-benzoxazin-4-one.
| Compound Name | 2-(2,4-dichlorophenyl)-2,3-dihydro-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 3107223 |
| Molecular Formula | C14H9Cl2NO2 |
| Molecular Weight | 294.14 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-2,3-dihydro-1,3-benzoxazin-4-one |
| SMILES | O=C1NC(c2ccc(Cl)cc2Cl)Oc2ccccc21 |
| InChI | InChI=1S/C14H9Cl2NO2/c15-8-5-6-9(11(16)7-8)14-17-13(18)10-3-1-2-4-12(10)19-14/h1-7,14H,(H,17,18) |
| InChIKey | GBUZCVHBZZUJAZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.14 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |