C18H18N2O2 — CID 3107378
1-[2,5-bis(4-methylphenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone (PubChem CID 3107378) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 1-[2,5-bis(4-methylphenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone.
| Compound Name | 1-[2,5-bis(4-methylphenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone |
|---|---|
| PubChem CID | 3107378 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 1-[2,5-bis(4-methylphenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone |
| SMILES | CC(=O)N1N=C(c2ccc(C)cc2)OC1c1ccc(C)cc1 |
| InChI | InChI=1S/C18H18N2O2/c1-12-4-8-15(9-5-12)17-19-20(14(3)21)18(22-17)16-10-6-13(2)7-11-16/h4-11,18H,1-3H3 |
| InChIKey | OBEHISVWEGNNJT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |