C19H20N4 — CID 31074314
1-[3-[3-(1H-pyrazol-5-yl)phenyl]phenyl]piperazine (PubChem CID 31074314) has the molecular formula C19H20N4 and a molecular weight of 304.40 g/mol. Its IUPAC name is 1-[3-[3-(1H-pyrazol-5-yl)phenyl]phenyl]piperazine.
| Compound Name | 1-[3-[3-(1H-pyrazol-5-yl)phenyl]phenyl]piperazine |
|---|---|
| PubChem CID | 31074314 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 1-[3-[3-(1H-pyrazol-5-yl)phenyl]phenyl]piperazine |
| SMILES | c1cc(-c2cccc(N3CCNCC3)c2)cc(-c2ccn[nH]2)c1 |
| InChI | InChI=1S/C19H20N4/c1-3-15(13-17(5-1)19-7-8-21-22-19)16-4-2-6-18(14-16)23-11-9-20-10-12-23/h1-8,13-14,20H,9-12H2,(H,21,22) |
| InChIKey | DALVLUCFELTWRM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |