About 5-methyl-2-phenyl-4-[(2,4,6-tribromophenyl)diazenyl]-1H-pyrazol-3-one
5-methyl-2-phenyl-4-[(2,4,6-tribromophenyl)diazenyl]-1H-pyrazol-3-one (PubChem CID 3107524) has the molecular formula C16H11Br3N4O
and a molecular weight of 515.00 g/mol. Its IUPAC name is 5-methyl-2-phenyl-4-[(2,4,6-tribromophenyl)diazenyl]-1H-pyrazol-3-one.
Molecular Properties
| Compound Name | 5-methyl-2-phenyl-4-[(2,4,6-tribromophenyl)diazenyl]-1H-pyrazol-3-one |
| PubChem CID | 3107524 |
| Molecular Formula | C16H11Br3N4O |
| Molecular Weight | 515.00 g/mol |
| Exact Mass | 511.85 |
| IUPAC Name | 5-methyl-2-phenyl-4-[(2,4,6-tribromophenyl)diazenyl]-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1/N=N/c1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C16H11Br3N4O/c1-9-14(16(24)23(22-9)11-5-3-2-4-6-11)20-21-15-12(18)7-10(17)8-13(15)19/h2-8,22H,1H3/b21-20+ |
| InChIKey | UKRDVQNSRQTSNI-QZQOTICOSA-N |
| XLogP | 6.18 |
| TPSA | 62.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 515.00 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-phenyl-4-[(2,4,6-tribromophenyl)diazenyl]-1H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-phenyl-4-[(2,4,6-tribromophenyl)diazenyl]-1H-pyrazol-3-one?
The IUPAC name of 5-methyl-2-phenyl-4-[(2,4,6-tribromophenyl)diazenyl]-1H-pyrazol-3-one (CID 3107524) is 5-methyl-2-phenyl-4-[(2,4,6-tribromophenyl)diazenyl]-1H-pyrazol-3-one.
What is the SMILES notation for 5-methyl-2-phenyl-4-[(2,4,6-tribromophenyl)diazenyl]-1H-pyrazol-3-one?
The canonical SMILES for 5-methyl-2-phenyl-4-[(2,4,6-tribromophenyl)diazenyl]-1H-pyrazol-3-one is Cc1[nH]n(-c2ccccc2)c(=O)c1/N=N/c1c(Br)cc(Br)cc1Br.
What is the InChIKey of 5-methyl-2-phenyl-4-[(2,4,6-tribromophenyl)diazenyl]-1H-pyrazol-3-one?
The InChIKey is UKRDVQNSRQTSNI-QZQOTICOSA-N. The full InChI is InChI=1S/C16H11Br3N4O/c1-9-14(16(24)23(22-9)11-5-3-2-4-6-11)20-21-15-12(18)7-10(17)8-13(15)19/h2-8,22H,1H3/b21-20+.
What are the key properties of 5-methyl-2-phenyl-4-[(2,4,6-tribromophenyl)diazenyl]-1H-pyrazol-3-one?
5-methyl-2-phenyl-4-[(2,4,6-tribromophenyl)diazenyl]-1H-pyrazol-3-one has a molecular weight of 515.00 g/mol, XLogP of 6.18, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-phenyl-4-[(2,4,6-tribromophenyl)diazenyl]-1H-pyrazol-3-one is sourced from PubChem (CID 3107524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).