About N-(3-imidazol-1-ylpropyl)-N'-phenyloxamide
N-(3-imidazol-1-ylpropyl)-N'-phenyloxamide (PubChem CID 3107634) has the molecular formula C14H16N4O2
and a molecular weight of 272.31 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-N'-phenyloxamide.
Molecular Properties
| Compound Name | N-(3-imidazol-1-ylpropyl)-N'-phenyloxamide |
| PubChem CID | 3107634 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-N'-phenyloxamide |
| SMILES | O=C(NCCCn1ccnc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C14H16N4O2/c19-13(14(20)17-12-5-2-1-3-6-12)16-7-4-9-18-10-8-15-11-18/h1-3,5-6,8,10-11H,4,7,9H2,(H,16,19)(H,17,20) |
| InChIKey | SXUOVYKRAILNRY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(3-imidazol-1-ylpropyl)-N'-phenyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-imidazol-1-ylpropyl)-N'-phenyloxamide?
The IUPAC name of N-(3-imidazol-1-ylpropyl)-N'-phenyloxamide (CID 3107634) is N-(3-imidazol-1-ylpropyl)-N'-phenyloxamide.
What is the SMILES notation for N-(3-imidazol-1-ylpropyl)-N'-phenyloxamide?
The canonical SMILES for N-(3-imidazol-1-ylpropyl)-N'-phenyloxamide is O=C(NCCCn1ccnc1)C(=O)Nc1ccccc1.
What is the InChIKey of N-(3-imidazol-1-ylpropyl)-N'-phenyloxamide?
The InChIKey is SXUOVYKRAILNRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O2/c19-13(14(20)17-12-5-2-1-3-6-12)16-7-4-9-18-10-8-15-11-18/h1-3,5-6,8,10-11H,4,7,9H2,(H,16,19)(H,17,20).
What are the key properties of N-(3-imidazol-1-ylpropyl)-N'-phenyloxamide?
N-(3-imidazol-1-ylpropyl)-N'-phenyloxamide has a molecular weight of 272.31 g/mol, XLogP of 1.03, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-imidazol-1-ylpropyl)-N'-phenyloxamide is sourced from PubChem (CID 3107634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).