C14H18ClN5 — CID 3107866
4-N-butyl-6-chloro-2-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 3107866) has the molecular formula C14H18ClN5 and a molecular weight of 291.79 g/mol. Its IUPAC name is 4-N-butyl-6-chloro-2-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-butyl-6-chloro-2-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3107866 |
| Molecular Formula | C14H18ClN5 |
| Molecular Weight | 291.79 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 4-N-butyl-6-chloro-2-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCNc1nc(Cl)nc(Nc2ccc(C)cc2)n1 |
| InChI | InChI=1S/C14H18ClN5/c1-3-4-9-16-13-18-12(15)19-14(20-13)17-11-7-5-10(2)6-8-11/h5-8H,3-4,9H2,1-2H3,(H2,16,17,18,19,20) |
| InChIKey | ZVXCALIJKGGYDH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.79 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|