C33H30N2O3 — CID 3108035
N-[1-[3-(4-methoxyphenyl)prop-2-enoyl]-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-phenylbenzamide (PubChem CID 3108035) has the molecular formula C33H30N2O3 and a molecular weight of 502.61 g/mol. Its IUPAC name is N-[1-[3-(4-methoxyphenyl)prop-2-enoyl]-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-phenylbenzamide.
| Compound Name | N-[1-[3-(4-methoxyphenyl)prop-2-enoyl]-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 3108035 |
| Molecular Formula | C33H30N2O3 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | N-[1-[3-(4-methoxyphenyl)prop-2-enoyl]-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-N-phenylbenzamide |
| SMILES | COc1ccc(C=CC(=O)N2c3ccccc3C(N(C(=O)c3ccccc3)c3ccccc3)CC2C)cc1 |
| InChI | InChI=1S/C33H30N2O3/c1-24-23-31(35(27-13-7-4-8-14-27)33(37)26-11-5-3-6-12-26)29-15-9-10-16-30(29)34(24)32(36)22-19-25-17-20-28(38-2)21-18-25/h3-22,24,31H,23H2,1-2H3 |
| InChIKey | LOWAFRBNKVSZPI-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|