C15H22O — CID 3108045
6-ethenyl-2,3,4,4a,6,6a,7,8,9,10b-decahydro-1H-benzo[c]chromene (PubChem CID 3108045) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 6-ethenyl-2,3,4,4a,6,6a,7,8,9,10b-decahydro-1H-benzo[c]chromene.
| Compound Name | 6-ethenyl-2,3,4,4a,6,6a,7,8,9,10b-decahydro-1H-benzo[c]chromene |
|---|---|
| PubChem CID | 3108045 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 6-ethenyl-2,3,4,4a,6,6a,7,8,9,10b-decahydro-1H-benzo[c]chromene |
| SMILES | C=CC1OC2CCCCC2C2=CCCCC21 |
| InChI | InChI=1S/C15H22O/c1-2-14-12-8-4-3-7-11(12)13-9-5-6-10-15(13)16-14/h2,7,12-15H,1,3-6,8-10H2 |
| InChIKey | MNWLUKWOQKIWCI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|