C14H15N7O3 — CID 3108793
N-[(4-methoxyphenyl)methyl]-4-methyl-N-[(4-methyl-1,2,5-oxadiazol-3-yl)diazenyl]-1,2,5-oxadiazol-3-amine (PubChem CID 3108793) has the molecular formula C14H15N7O3 and a molecular weight of 329.32 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-4-methyl-N-[(4-methyl-1,2,5-oxadiazol-3-yl)diazenyl]-1,2,5-oxadiazol-3-amine.
| Compound Name | N-[(4-methoxyphenyl)methyl]-4-methyl-N-[(4-methyl-1,2,5-oxadiazol-3-yl)diazenyl]-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 3108793 |
| Molecular Formula | C14H15N7O3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-4-methyl-N-[(4-methyl-1,2,5-oxadiazol-3-yl)diazenyl]-1,2,5-oxadiazol-3-amine |
| SMILES | COc1ccc(CN(/N=N/c2nonc2C)c2nonc2C)cc1 |
| InChI | InChI=1S/C14H15N7O3/c1-9-13(18-23-16-9)15-20-21(14-10(2)17-24-19-14)8-11-4-6-12(22-3)7-5-11/h4-7H,8H2,1-3H3/b20-15+ |
| InChIKey | HPIJPFPWFUTKSK-HMMYKYKNSA-N |
| XLogP | 2.78 |
| TPSA | 115.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|