C23H18N6O4 — CID 31088164
N-(3-nitrophenyl)-2-[(1R)-2-oxo-3-(pyridin-3-ylmethyl)-1H-imidazo[1,2-a]benzimidazol-1-yl]acetamide (PubChem CID 31088164) has the molecular formula C23H18N6O4 and a molecular weight of 442.44 g/mol. Its IUPAC name is N-(3-nitrophenyl)-2-[(1R)-2-oxo-3-(pyridin-3-ylmethyl)-1H-imidazo[1,2-a]benzimidazol-1-yl]acetamide.
| Compound Name | N-(3-nitrophenyl)-2-[(1R)-2-oxo-3-(pyridin-3-ylmethyl)-1H-imidazo[1,2-a]benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 31088164 |
| Molecular Formula | C23H18N6O4 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | N-(3-nitrophenyl)-2-[(1R)-2-oxo-3-(pyridin-3-ylmethyl)-1H-imidazo[1,2-a]benzimidazol-1-yl]acetamide |
| SMILES | O=C(C[C@@H]1C(=O)N(Cc2cccnc2)c2nc3ccccc3n21)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H18N6O4/c30-21(25-16-6-3-7-17(11-16)29(32)33)12-20-22(31)27(14-15-5-4-10-24-13-15)23-26-18-8-1-2-9-19(18)28(20)23/h1-11,13,20H,12,14H2,(H,25,30)/t20-/m1/s1 |
| InChIKey | APVFFQONCZVKSM-HXUWFJFHSA-N |
| XLogP | 3.46 |
| TPSA | 123.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|