C13H17NO3S2 — CID 3108947
3-(2,5,7-trimethyl-1,3-benzothiazol-3-ium-3-yl)propane-1-sulfonate (PubChem CID 3108947) has the molecular formula C13H17NO3S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 3-(2,5,7-trimethyl-1,3-benzothiazol-3-ium-3-yl)propane-1-sulfonate.
| Compound Name | 3-(2,5,7-trimethyl-1,3-benzothiazol-3-ium-3-yl)propane-1-sulfonate |
|---|---|
| PubChem CID | 3108947 |
| Molecular Formula | C13H17NO3S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 3-(2,5,7-trimethyl-1,3-benzothiazol-3-ium-3-yl)propane-1-sulfonate |
| SMILES | Cc1cc(C)c2sc(C)[n+](CCCS(=O)(=O)[O-])c2c1 |
| InChI | InChI=1S/C13H17NO3S2/c1-9-7-10(2)13-12(8-9)14(11(3)18-13)5-4-6-19(15,16)17/h7-8H,4-6H2,1-3H3 |
| InChIKey | OWNSUCFKXCIRGE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|