About 4-[1-(2,6-diphenyl-4-pyridinyl)-2-phenylethyl]-2,6-diphenylpyridine
4-[1-(2,6-diphenyl-4-pyridinyl)-2-phenylethyl]-2,6-diphenylpyridine (PubChem CID 3109175) has the molecular formula C42H32N2
and a molecular weight of 564.73 g/mol. Its IUPAC name is 4-[1-(2,6-diphenyl-4-pyridinyl)-2-phenylethyl]-2,6-diphenylpyridine.
Molecular Properties
| Compound Name | 4-[1-(2,6-diphenyl-4-pyridinyl)-2-phenylethyl]-2,6-diphenylpyridine |
| PubChem CID | 3109175 |
| Molecular Formula | C42H32N2 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | 4-[1-(2,6-diphenyl-4-pyridinyl)-2-phenylethyl]-2,6-diphenylpyridine |
| SMILES | c1ccc(CC(c2cc(-c3ccccc3)nc(-c3ccccc3)c2)c2cc(-c3ccccc3)nc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C42H32N2/c1-6-16-31(17-7-1)26-38(36-27-39(32-18-8-2-9-19-32)43-40(28-36)33-20-10-3-11-21-33)37-29-41(34-22-12-4-13-23-34)44-42(30-37)35-24-14-5-15-25-35/h1-25,27-30,38H,26H2 |
| InChIKey | PGROCVZRMFMYGH-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[1-(2,6-diphenyl-4-pyridinyl)-2-phenylethyl]-2,6-diphenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(2,6-diphenyl-4-pyridinyl)-2-phenylethyl]-2,6-diphenylpyridine?
The IUPAC name of 4-[1-(2,6-diphenyl-4-pyridinyl)-2-phenylethyl]-2,6-diphenylpyridine (CID 3109175) is 4-[1-(2,6-diphenyl-4-pyridinyl)-2-phenylethyl]-2,6-diphenylpyridine.
What is the SMILES notation for 4-[1-(2,6-diphenyl-4-pyridinyl)-2-phenylethyl]-2,6-diphenylpyridine?
The canonical SMILES for 4-[1-(2,6-diphenyl-4-pyridinyl)-2-phenylethyl]-2,6-diphenylpyridine is c1ccc(CC(c2cc(-c3ccccc3)nc(-c3ccccc3)c2)c2cc(-c3ccccc3)nc(-c3ccccc3)c2)cc1.
What is the InChIKey of 4-[1-(2,6-diphenyl-4-pyridinyl)-2-phenylethyl]-2,6-diphenylpyridine?
The InChIKey is PGROCVZRMFMYGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H32N2/c1-6-16-31(17-7-1)26-38(36-27-39(32-18-8-2-9-19-32)43-40(28-36)33-20-10-3-11-21-33)37-29-41(34-22-12-4-13-23-34)44-42(30-37)35-24-14-5-15-25-35/h1-25,27-30,38H,26H2.
What are the key properties of 4-[1-(2,6-diphenyl-4-pyridinyl)-2-phenylethyl]-2,6-diphenylpyridine?
4-[1-(2,6-diphenyl-4-pyridinyl)-2-phenylethyl]-2,6-diphenylpyridine has a molecular weight of 564.73 g/mol, XLogP of 10.52, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(2,6-diphenyl-4-pyridinyl)-2-phenylethyl]-2,6-diphenylpyridine is sourced from PubChem (CID 3109175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).