C12H9F12N3O — CID 3109471
4-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-6-methylpyrimidin-2-amine (PubChem CID 3109471) has the molecular formula C12H9F12N3O and a molecular weight of 439.20 g/mol. Its IUPAC name is 4-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-6-methylpyrimidin-2-amine.
| Compound Name | 4-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 3109471 |
| Molecular Formula | C12H9F12N3O |
| Molecular Weight | 439.20 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | 4-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-6-methylpyrimidin-2-amine |
| SMILES | Cc1cc(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)nc(N)n1 |
| InChI | InChI=1S/C12H9F12N3O/c1-4-2-5(27-7(25)26-4)28-3-8(15,16)10(19,20)12(23,24)11(21,22)9(17,18)6(13)14/h2,6H,3H2,1H3,(H2,25,26,27) |
| InChIKey | OLEYDHPWPMZKIR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.20 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|