About (2-amino-1,3-thiazol-5-yl) thiocyanate
(2-amino-1,3-thiazol-5-yl) thiocyanate (PubChem CID 3109677) has the molecular formula C4H3N3S2
and a molecular weight of 157.22 g/mol. Its IUPAC name is (2-amino-1,3-thiazol-5-yl) thiocyanate.
Molecular Properties
| Compound Name | (2-amino-1,3-thiazol-5-yl) thiocyanate |
| PubChem CID | 3109677 |
| Molecular Formula | C4H3N3S2 |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 156.98 |
| IUPAC Name | (2-amino-1,3-thiazol-5-yl) thiocyanate |
| SMILES | N#CSc1cnc(N)s1 |
| InChI | InChI=1S/C4H3N3S2/c5-2-8-3-1-7-4(6)9-3/h1H,(H2,6,7) |
| InChIKey | HUMARXMRTXDPPK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-1,3-thiazol-5-yl) thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-1,3-thiazol-5-yl) thiocyanate?
The IUPAC name of (2-amino-1,3-thiazol-5-yl) thiocyanate (CID 3109677) is (2-amino-1,3-thiazol-5-yl) thiocyanate.
What is the SMILES notation for (2-amino-1,3-thiazol-5-yl) thiocyanate?
The canonical SMILES for (2-amino-1,3-thiazol-5-yl) thiocyanate is N#CSc1cnc(N)s1.
What is the InChIKey of (2-amino-1,3-thiazol-5-yl) thiocyanate?
The InChIKey is HUMARXMRTXDPPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3N3S2/c5-2-8-3-1-7-4(6)9-3/h1H,(H2,6,7).
What are the key properties of (2-amino-1,3-thiazol-5-yl) thiocyanate?
(2-amino-1,3-thiazol-5-yl) thiocyanate has a molecular weight of 157.22 g/mol, XLogP of 1.30, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-1,3-thiazol-5-yl) thiocyanate is sourced from PubChem (CID 3109677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).