About 4-methyl-3-[4-oxo-4-(3-oxopiperazin-1-yl)butyl]-1,3-thiazol-2-one
4-methyl-3-[4-oxo-4-(3-oxopiperazin-1-yl)butyl]-1,3-thiazol-2-one (PubChem CID 31096811) has the molecular formula C12H17N3O3S
and a molecular weight of 283.35 g/mol. Its IUPAC name is 4-methyl-3-[4-oxo-4-(3-oxopiperazin-1-yl)butyl]-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4-methyl-3-[4-oxo-4-(3-oxopiperazin-1-yl)butyl]-1,3-thiazol-2-one |
| PubChem CID | 31096811 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 4-methyl-3-[4-oxo-4-(3-oxopiperazin-1-yl)butyl]-1,3-thiazol-2-one |
| SMILES | Cc1csc(=O)n1CCCC(=O)N1CCNC(=O)C1 |
| InChI | InChI=1S/C12H17N3O3S/c1-9-8-19-12(18)15(9)5-2-3-11(17)14-6-4-13-10(16)7-14/h8H,2-7H2,1H3,(H,13,16) |
| InChIKey | ZROKFQRCSSHHJH-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methyl-3-[4-oxo-4-(3-oxopiperazin-1-yl)butyl]-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-[4-oxo-4-(3-oxopiperazin-1-yl)butyl]-1,3-thiazol-2-one?
The IUPAC name of 4-methyl-3-[4-oxo-4-(3-oxopiperazin-1-yl)butyl]-1,3-thiazol-2-one (CID 31096811) is 4-methyl-3-[4-oxo-4-(3-oxopiperazin-1-yl)butyl]-1,3-thiazol-2-one.
What is the SMILES notation for 4-methyl-3-[4-oxo-4-(3-oxopiperazin-1-yl)butyl]-1,3-thiazol-2-one?
The canonical SMILES for 4-methyl-3-[4-oxo-4-(3-oxopiperazin-1-yl)butyl]-1,3-thiazol-2-one is Cc1csc(=O)n1CCCC(=O)N1CCNC(=O)C1.
What is the InChIKey of 4-methyl-3-[4-oxo-4-(3-oxopiperazin-1-yl)butyl]-1,3-thiazol-2-one?
The InChIKey is ZROKFQRCSSHHJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O3S/c1-9-8-19-12(18)15(9)5-2-3-11(17)14-6-4-13-10(16)7-14/h8H,2-7H2,1H3,(H,13,16).
What are the key properties of 4-methyl-3-[4-oxo-4-(3-oxopiperazin-1-yl)butyl]-1,3-thiazol-2-one?
4-methyl-3-[4-oxo-4-(3-oxopiperazin-1-yl)butyl]-1,3-thiazol-2-one has a molecular weight of 283.35 g/mol, XLogP of -0.04, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-[4-oxo-4-(3-oxopiperazin-1-yl)butyl]-1,3-thiazol-2-one is sourced from PubChem (CID 31096811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).