About 2-(benzenesulfonyloxy)-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid
2-(benzenesulfonyloxy)-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid (PubChem CID 3109735) has the molecular formula C19H11NO7S
and a molecular weight of 397.36 g/mol. Its IUPAC name is 2-(benzenesulfonyloxy)-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid.
Molecular Properties
| Compound Name | 2-(benzenesulfonyloxy)-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid |
| PubChem CID | 3109735 |
| Molecular Formula | C19H11NO7S |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 2-(benzenesulfonyloxy)-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)c1ccccc1)C2=O |
| InChI | InChI=1S/C19H11NO7S/c21-17-14-8-4-7-12-13(19(23)24)9-10-15(16(12)14)18(22)20(17)27-28(25,26)11-5-2-1-3-6-11/h1-10H,(H,23,24) |
| InChIKey | NSTLWHSMPLBQQH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(benzenesulfonyloxy)-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyloxy)-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid?
The IUPAC name of 2-(benzenesulfonyloxy)-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid (CID 3109735) is 2-(benzenesulfonyloxy)-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid.
What is the SMILES notation for 2-(benzenesulfonyloxy)-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid?
The canonical SMILES for 2-(benzenesulfonyloxy)-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid is O=C(O)c1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)c1ccccc1)C2=O.
What is the InChIKey of 2-(benzenesulfonyloxy)-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid?
The InChIKey is NSTLWHSMPLBQQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11NO7S/c21-17-14-8-4-7-12-13(19(23)24)9-10-15(16(12)14)18(22)20(17)27-28(25,26)11-5-2-1-3-6-11/h1-10H,(H,23,24).
What are the key properties of 2-(benzenesulfonyloxy)-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid?
2-(benzenesulfonyloxy)-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid has a molecular weight of 397.36 g/mol, XLogP of 2.45, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyloxy)-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid is sourced from PubChem (CID 3109735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).