C11H5F10N3O2 — CID 3109835
2,2,3,3,3-pentafluoro-N-[6-(2,2,3,3,3-pentafluoropropanoylamino)-2-pyridinyl]propanamide (PubChem CID 3109835) has the molecular formula C11H5F10N3O2 and a molecular weight of 401.16 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-[6-(2,2,3,3,3-pentafluoropropanoylamino)-2-pyridinyl]propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-[6-(2,2,3,3,3-pentafluoropropanoylamino)-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 3109835 |
| Molecular Formula | C11H5F10N3O2 |
| Molecular Weight | 401.16 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-[6-(2,2,3,3,3-pentafluoropropanoylamino)-2-pyridinyl]propanamide |
| SMILES | O=C(Nc1cccc(NC(=O)C(F)(F)C(F)(F)F)n1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H5F10N3O2/c12-8(13,10(16,17)18)6(25)23-4-2-1-3-5(22-4)24-7(26)9(14,15)11(19,20)21/h1-3H,(H2,22,23,24,25,26) |
| InChIKey | APFXDDGVNGFVHX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.16 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|