About 1-benzhydryl-5-[(3,5-dichloro-2-methoxyphenyl)-pyrrolidin-1-ylmethyl]tetrazole
1-benzhydryl-5-[(3,5-dichloro-2-methoxyphenyl)-pyrrolidin-1-ylmethyl]tetrazole (PubChem CID 3109947) has the molecular formula C26H25Cl2N5O
and a molecular weight of 494.43 g/mol. Its IUPAC name is 1-benzhydryl-5-[(3,5-dichloro-2-methoxyphenyl)-pyrrolidin-1-ylmethyl]tetrazole.
Molecular Properties
| Compound Name | 1-benzhydryl-5-[(3,5-dichloro-2-methoxyphenyl)-pyrrolidin-1-ylmethyl]tetrazole |
| PubChem CID | 3109947 |
| Molecular Formula | C26H25Cl2N5O |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | 1-benzhydryl-5-[(3,5-dichloro-2-methoxyphenyl)-pyrrolidin-1-ylmethyl]tetrazole |
| SMILES | COc1c(Cl)cc(Cl)cc1C(c1nnnn1C(c1ccccc1)c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C26H25Cl2N5O/c1-34-25-21(16-20(27)17-22(25)28)24(32-14-8-9-15-32)26-29-30-31-33(26)23(18-10-4-2-5-11-18)19-12-6-3-7-13-19/h2-7,10-13,16-17,23-24H,8-9,14-15H2,1H3 |
| InChIKey | LTDXGOCTQYKMAS-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-benzhydryl-5-[(3,5-dichloro-2-methoxyphenyl)-pyrrolidin-1-ylmethyl]tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzhydryl-5-[(3,5-dichloro-2-methoxyphenyl)-pyrrolidin-1-ylmethyl]tetrazole?
The IUPAC name of 1-benzhydryl-5-[(3,5-dichloro-2-methoxyphenyl)-pyrrolidin-1-ylmethyl]tetrazole (CID 3109947) is 1-benzhydryl-5-[(3,5-dichloro-2-methoxyphenyl)-pyrrolidin-1-ylmethyl]tetrazole.
What is the SMILES notation for 1-benzhydryl-5-[(3,5-dichloro-2-methoxyphenyl)-pyrrolidin-1-ylmethyl]tetrazole?
The canonical SMILES for 1-benzhydryl-5-[(3,5-dichloro-2-methoxyphenyl)-pyrrolidin-1-ylmethyl]tetrazole is COc1c(Cl)cc(Cl)cc1C(c1nnnn1C(c1ccccc1)c1ccccc1)N1CCCC1.
What is the InChIKey of 1-benzhydryl-5-[(3,5-dichloro-2-methoxyphenyl)-pyrrolidin-1-ylmethyl]tetrazole?
The InChIKey is LTDXGOCTQYKMAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25Cl2N5O/c1-34-25-21(16-20(27)17-22(25)28)24(32-14-8-9-15-32)26-29-30-31-33(26)23(18-10-4-2-5-11-18)19-12-6-3-7-13-19/h2-7,10-13,16-17,23-24H,8-9,14-15H2,1H3.
What are the key properties of 1-benzhydryl-5-[(3,5-dichloro-2-methoxyphenyl)-pyrrolidin-1-ylmethyl]tetrazole?
1-benzhydryl-5-[(3,5-dichloro-2-methoxyphenyl)-pyrrolidin-1-ylmethyl]tetrazole has a molecular weight of 494.43 g/mol, XLogP of 5.81, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzhydryl-5-[(3,5-dichloro-2-methoxyphenyl)-pyrrolidin-1-ylmethyl]tetrazole is sourced from PubChem (CID 3109947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).