About 3,4-dimethyl-2,6-diphenylpyridine
3,4-dimethyl-2,6-diphenylpyridine (PubChem CID 3110002) has the molecular formula C19H17N
and a molecular weight of 259.35 g/mol. Its IUPAC name is 3,4-dimethyl-2,6-diphenylpyridine.
Molecular Properties
| Compound Name | 3,4-dimethyl-2,6-diphenylpyridine |
| PubChem CID | 3110002 |
| Molecular Formula | C19H17N |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 3,4-dimethyl-2,6-diphenylpyridine |
| SMILES | Cc1cc(-c2ccccc2)nc(-c2ccccc2)c1C |
| InChI | InChI=1S/C19H17N/c1-14-13-18(16-9-5-3-6-10-16)20-19(15(14)2)17-11-7-4-8-12-17/h3-13H,1-2H3 |
| InChIKey | ZSAQYCPABZZALP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dimethyl-2,6-diphenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-2,6-diphenylpyridine?
The IUPAC name of 3,4-dimethyl-2,6-diphenylpyridine (CID 3110002) is 3,4-dimethyl-2,6-diphenylpyridine.
What is the SMILES notation for 3,4-dimethyl-2,6-diphenylpyridine?
The canonical SMILES for 3,4-dimethyl-2,6-diphenylpyridine is Cc1cc(-c2ccccc2)nc(-c2ccccc2)c1C.
What is the InChIKey of 3,4-dimethyl-2,6-diphenylpyridine?
The InChIKey is ZSAQYCPABZZALP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N/c1-14-13-18(16-9-5-3-6-10-16)20-19(15(14)2)17-11-7-4-8-12-17/h3-13H,1-2H3.
What are the key properties of 3,4-dimethyl-2,6-diphenylpyridine?
3,4-dimethyl-2,6-diphenylpyridine has a molecular weight of 259.35 g/mol, XLogP of 5.03, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-2,6-diphenylpyridine is sourced from PubChem (CID 3110002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).