C22H21N5OS — CID 31100069
2-[(4-benzyl-5-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-(cyanomethyl)-N-phenylacetamide (PubChem CID 31100069) has the molecular formula C22H21N5OS and a molecular weight of 403.51 g/mol. Its IUPAC name is 2-[(4-benzyl-5-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-(cyanomethyl)-N-phenylacetamide.
| Compound Name | 2-[(4-benzyl-5-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-(cyanomethyl)-N-phenylacetamide |
|---|---|
| PubChem CID | 31100069 |
| Molecular Formula | C22H21N5OS |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2-[(4-benzyl-5-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-(cyanomethyl)-N-phenylacetamide |
| SMILES | N#CCN(C(=O)CSc1nnc(C2CC2)n1Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21N5OS/c23-13-14-26(19-9-5-2-6-10-19)20(28)16-29-22-25-24-21(18-11-12-18)27(22)15-17-7-3-1-4-8-17/h1-10,18H,11-12,14-16H2 |
| InChIKey | FKJZXKCFSIMPRP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 74.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|