About [3-(cyclohexanecarbonyloxy)-1,4-dioxan-2-yl] cyclohexanecarboxylate
[3-(cyclohexanecarbonyloxy)-1,4-dioxan-2-yl] cyclohexanecarboxylate (PubChem CID 3110574) has the molecular formula C18H28O6
and a molecular weight of 340.42 g/mol. Its IUPAC name is [3-(cyclohexanecarbonyloxy)-1,4-dioxan-2-yl] cyclohexanecarboxylate.
Molecular Properties
| Compound Name | [3-(cyclohexanecarbonyloxy)-1,4-dioxan-2-yl] cyclohexanecarboxylate |
| PubChem CID | 3110574 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | [3-(cyclohexanecarbonyloxy)-1,4-dioxan-2-yl] cyclohexanecarboxylate |
| SMILES | O=C(OC1OCCOC1OC(=O)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C18H28O6/c19-15(13-7-3-1-4-8-13)23-17-18(22-12-11-21-17)24-16(20)14-9-5-2-6-10-14/h13-14,17-18H,1-12H2 |
| InChIKey | DBTAJZRTQFNCNW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-(cyclohexanecarbonyloxy)-1,4-dioxan-2-yl] cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(cyclohexanecarbonyloxy)-1,4-dioxan-2-yl] cyclohexanecarboxylate?
The IUPAC name of [3-(cyclohexanecarbonyloxy)-1,4-dioxan-2-yl] cyclohexanecarboxylate (CID 3110574) is [3-(cyclohexanecarbonyloxy)-1,4-dioxan-2-yl] cyclohexanecarboxylate.
What is the SMILES notation for [3-(cyclohexanecarbonyloxy)-1,4-dioxan-2-yl] cyclohexanecarboxylate?
The canonical SMILES for [3-(cyclohexanecarbonyloxy)-1,4-dioxan-2-yl] cyclohexanecarboxylate is O=C(OC1OCCOC1OC(=O)C1CCCCC1)C1CCCCC1.
What is the InChIKey of [3-(cyclohexanecarbonyloxy)-1,4-dioxan-2-yl] cyclohexanecarboxylate?
The InChIKey is DBTAJZRTQFNCNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O6/c19-15(13-7-3-1-4-8-13)23-17-18(22-12-11-21-17)24-16(20)14-9-5-2-6-10-14/h13-14,17-18H,1-12H2.
What are the key properties of [3-(cyclohexanecarbonyloxy)-1,4-dioxan-2-yl] cyclohexanecarboxylate?
[3-(cyclohexanecarbonyloxy)-1,4-dioxan-2-yl] cyclohexanecarboxylate has a molecular weight of 340.42 g/mol, XLogP of 2.93, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(cyclohexanecarbonyloxy)-1,4-dioxan-2-yl] cyclohexanecarboxylate is sourced from PubChem (CID 3110574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).