C14H11Br2N2O3+ — CID 3110598
2-(3,5-dibromopyridin-1-ium-1-yl)-1-(4-methyl-3-nitrophenyl)ethanone (PubChem CID 3110598) has the molecular formula C14H11Br2N2O3+ and a molecular weight of 415.06 g/mol. Its IUPAC name is 2-(3,5-dibromopyridin-1-ium-1-yl)-1-(4-methyl-3-nitrophenyl)ethanone.
| Compound Name | 2-(3,5-dibromopyridin-1-ium-1-yl)-1-(4-methyl-3-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 3110598 |
| Molecular Formula | C14H11Br2N2O3+ |
| Molecular Weight | 415.06 g/mol |
| Exact Mass | 412.91 |
| IUPAC Name | 2-(3,5-dibromopyridin-1-ium-1-yl)-1-(4-methyl-3-nitrophenyl)ethanone |
| SMILES | Cc1ccc(C(=O)C[n+]2cc(Br)cc(Br)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H11Br2N2O3/c1-9-2-3-10(4-13(9)18(20)21)14(19)8-17-6-11(15)5-12(16)7-17/h2-7H,8H2,1H3/q+1 |
| InChIKey | UCHTZIQOFSGPQN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 64.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.06 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|