About N-(1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)adamantane-1-carboxamide
N-(1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)adamantane-1-carboxamide (PubChem CID 3110684) has the molecular formula C29H31N3O
and a molecular weight of 437.59 g/mol. Its IUPAC name is N-(1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)adamantane-1-carboxamide.
Molecular Properties
| Compound Name | N-(1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)adamantane-1-carboxamide |
| PubChem CID | 3110684 |
| Molecular Formula | C29H31N3O |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | N-(1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)adamantane-1-carboxamide |
| SMILES | O=C(Nc1c2c(nc3ccccc13)N(Cc1ccccc1)CC2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C29H31N3O/c33-28(29-15-20-12-21(16-29)14-22(13-20)17-29)31-26-23-8-4-5-9-25(23)30-27-24(26)10-11-32(27)18-19-6-2-1-3-7-19/h1-9,20-22H,10-18H2,(H,30,31,33) |
| InChIKey | MXCTUWTYSBLDEZ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)adamantane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)adamantane-1-carboxamide?
The IUPAC name of N-(1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)adamantane-1-carboxamide (CID 3110684) is N-(1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)adamantane-1-carboxamide.
What is the SMILES notation for N-(1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)adamantane-1-carboxamide?
The canonical SMILES for N-(1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)adamantane-1-carboxamide is O=C(Nc1c2c(nc3ccccc13)N(Cc1ccccc1)CC2)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of N-(1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)adamantane-1-carboxamide?
The InChIKey is MXCTUWTYSBLDEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H31N3O/c33-28(29-15-20-12-21(16-29)14-22(13-20)17-29)31-26-23-8-4-5-9-25(23)30-27-24(26)10-11-32(27)18-19-6-2-1-3-7-19/h1-9,20-22H,10-18H2,(H,30,31,33).
What are the key properties of N-(1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)adamantane-1-carboxamide?
N-(1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)adamantane-1-carboxamide has a molecular weight of 437.59 g/mol, XLogP of 5.95, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)adamantane-1-carboxamide is sourced from PubChem (CID 3110684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).