About 2-amino-1-[10-(2-aminopropanoyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]propan-1-one
2-amino-1-[10-(2-aminopropanoyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]propan-1-one (PubChem CID 3110896) has the molecular formula C14H28N4O4
and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-amino-1-[10-(2-aminopropanoyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]propan-1-one.
Molecular Properties
| Compound Name | 2-amino-1-[10-(2-aminopropanoyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]propan-1-one |
| PubChem CID | 3110896 |
| Molecular Formula | C14H28N4O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | 2-amino-1-[10-(2-aminopropanoyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]propan-1-one |
| SMILES | CC(N)C(=O)N1CCOCCN(C(=O)C(C)N)CCOCC1 |
| InChI | InChI=1S/C14H28N4O4/c1-11(15)13(19)17-3-7-21-9-5-18(14(20)12(2)16)6-10-22-8-4-17/h11-12H,3-10,15-16H2,1-2H3 |
| InChIKey | GHWCJUUQVLXDCS-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 111.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-1-[10-(2-aminopropanoyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-[10-(2-aminopropanoyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]propan-1-one?
The IUPAC name of 2-amino-1-[10-(2-aminopropanoyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]propan-1-one (CID 3110896) is 2-amino-1-[10-(2-aminopropanoyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]propan-1-one.
What is the SMILES notation for 2-amino-1-[10-(2-aminopropanoyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]propan-1-one?
The canonical SMILES for 2-amino-1-[10-(2-aminopropanoyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]propan-1-one is CC(N)C(=O)N1CCOCCN(C(=O)C(C)N)CCOCC1.
What is the InChIKey of 2-amino-1-[10-(2-aminopropanoyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]propan-1-one?
The InChIKey is GHWCJUUQVLXDCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N4O4/c1-11(15)13(19)17-3-7-21-9-5-18(14(20)12(2)16)6-10-22-8-4-17/h11-12H,3-10,15-16H2,1-2H3.
What are the key properties of 2-amino-1-[10-(2-aminopropanoyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]propan-1-one?
2-amino-1-[10-(2-aminopropanoyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]propan-1-one has a molecular weight of 316.40 g/mol, XLogP of -1.62, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-[10-(2-aminopropanoyl)-1,7-dioxa-4,10-diazacyclododec-4-yl]propan-1-one is sourced from PubChem (CID 3110896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).