C21H19NO8 — CID 3111000
tetramethyl 11bH-benzo[h]quinolizine-1,2,3,4-tetracarboxylate (PubChem CID 3111000) has the molecular formula C21H19NO8 and a molecular weight of 413.38 g/mol. Its IUPAC name is tetramethyl 11bH-benzo[h]quinolizine-1,2,3,4-tetracarboxylate.
| Compound Name | tetramethyl 11bH-benzo[h]quinolizine-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 3111000 |
| Molecular Formula | C21H19NO8 |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | tetramethyl 11bH-benzo[h]quinolizine-1,2,3,4-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2c3ccccc3C=CN2C(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C21H19NO8/c1-27-18(23)13-14(19(24)28-2)16-12-8-6-5-7-11(12)9-10-22(16)17(21(26)30-4)15(13)20(25)29-3/h5-10,16H,1-4H3 |
| InChIKey | KYHISUHKDYOMRA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|