C27H15Cl2F3N4O3 — CID 3111017
[4-[(3,4-dichlorophenyl)carbamoyl]phenyl] 5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 3111017) has the molecular formula C27H15Cl2F3N4O3 and a molecular weight of 571.34 g/mol. Its IUPAC name is [4-[(3,4-dichlorophenyl)carbamoyl]phenyl] 5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | [4-[(3,4-dichlorophenyl)carbamoyl]phenyl] 5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 3111017 |
| Molecular Formula | C27H15Cl2F3N4O3 |
| Molecular Weight | 571.34 g/mol |
| Exact Mass | 570.05 |
| IUPAC Name | [4-[(3,4-dichlorophenyl)carbamoyl]phenyl] 5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)c1ccc(OC(=O)c2cc3nc(-c4ccccc4)cc(C(F)(F)F)n3n2)cc1 |
| InChI | InChI=1S/C27H15Cl2F3N4O3/c28-19-11-8-17(12-20(19)29)33-25(37)16-6-9-18(10-7-16)39-26(38)22-14-24-34-21(15-4-2-1-3-5-15)13-23(27(30,31)32)36(24)35-22/h1-14H,(H,33,37) |
| InChIKey | NMMOPUOIIBOEDL-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.34 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|