C15H15Cl4NO5 — CID 3111052
ethyl 2-[(2,2-dichloroacetyl)amino]-3-(2,2-dichloroacetyl)oxy-3-phenylpropanoate (PubChem CID 3111052) has the molecular formula C15H15Cl4NO5 and a molecular weight of 431.10 g/mol. Its IUPAC name is ethyl 2-[(2,2-dichloroacetyl)amino]-3-(2,2-dichloroacetyl)oxy-3-phenylpropanoate.
| Compound Name | ethyl 2-[(2,2-dichloroacetyl)amino]-3-(2,2-dichloroacetyl)oxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 3111052 |
| Molecular Formula | C15H15Cl4NO5 |
| Molecular Weight | 431.10 g/mol |
| Exact Mass | 428.97 |
| IUPAC Name | ethyl 2-[(2,2-dichloroacetyl)amino]-3-(2,2-dichloroacetyl)oxy-3-phenylpropanoate |
| SMILES | CCOC(=O)C(NC(=O)C(Cl)Cl)C(OC(=O)C(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C15H15Cl4NO5/c1-2-24-14(22)9(20-13(21)11(16)17)10(25-15(23)12(18)19)8-6-4-3-5-7-8/h3-7,9-12H,2H2,1H3,(H,20,21) |
| InChIKey | GPGUHASJQNXDSM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.10 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|