About 5-amino-2-anilino-7-(4-bromophenyl)thieno[3,2-b]pyridine-3,6-dicarbonitrile
5-amino-2-anilino-7-(4-bromophenyl)thieno[3,2-b]pyridine-3,6-dicarbonitrile (PubChem CID 3111149) has the molecular formula C21H12BrN5S
and a molecular weight of 446.33 g/mol. Its IUPAC name is 5-amino-2-anilino-7-(4-bromophenyl)thieno[3,2-b]pyridine-3,6-dicarbonitrile.
Molecular Properties
| Compound Name | 5-amino-2-anilino-7-(4-bromophenyl)thieno[3,2-b]pyridine-3,6-dicarbonitrile |
| PubChem CID | 3111149 |
| Molecular Formula | C21H12BrN5S |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 445.00 |
| IUPAC Name | 5-amino-2-anilino-7-(4-bromophenyl)thieno[3,2-b]pyridine-3,6-dicarbonitrile |
| SMILES | N#Cc1c(N)nc2c(C#N)c(Nc3ccccc3)sc2c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H12BrN5S/c22-13-8-6-12(7-9-13)17-15(10-23)20(25)27-18-16(11-24)21(28-19(17)18)26-14-4-2-1-3-5-14/h1-9,26H,(H2,25,27) |
| InChIKey | QFUTXJXIJKYUDU-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 98.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-amino-2-anilino-7-(4-bromophenyl)thieno[3,2-b]pyridine-3,6-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-anilino-7-(4-bromophenyl)thieno[3,2-b]pyridine-3,6-dicarbonitrile?
The IUPAC name of 5-amino-2-anilino-7-(4-bromophenyl)thieno[3,2-b]pyridine-3,6-dicarbonitrile (CID 3111149) is 5-amino-2-anilino-7-(4-bromophenyl)thieno[3,2-b]pyridine-3,6-dicarbonitrile.
What is the SMILES notation for 5-amino-2-anilino-7-(4-bromophenyl)thieno[3,2-b]pyridine-3,6-dicarbonitrile?
The canonical SMILES for 5-amino-2-anilino-7-(4-bromophenyl)thieno[3,2-b]pyridine-3,6-dicarbonitrile is N#Cc1c(N)nc2c(C#N)c(Nc3ccccc3)sc2c1-c1ccc(Br)cc1.
What is the InChIKey of 5-amino-2-anilino-7-(4-bromophenyl)thieno[3,2-b]pyridine-3,6-dicarbonitrile?
The InChIKey is QFUTXJXIJKYUDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12BrN5S/c22-13-8-6-12(7-9-13)17-15(10-23)20(25)27-18-16(11-24)21(28-19(17)18)26-14-4-2-1-3-5-14/h1-9,26H,(H2,25,27).
What are the key properties of 5-amino-2-anilino-7-(4-bromophenyl)thieno[3,2-b]pyridine-3,6-dicarbonitrile?
5-amino-2-anilino-7-(4-bromophenyl)thieno[3,2-b]pyridine-3,6-dicarbonitrile has a molecular weight of 446.33 g/mol, XLogP of 5.79, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-anilino-7-(4-bromophenyl)thieno[3,2-b]pyridine-3,6-dicarbonitrile is sourced from PubChem (CID 3111149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).