C13H10BrF6N5O — CID 3112025
2-N-(4-bromophenyl)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 3112025) has the molecular formula C13H10BrF6N5O and a molecular weight of 446.15 g/mol. Its IUPAC name is 2-N-(4-bromophenyl)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(4-bromophenyl)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3112025 |
| Molecular Formula | C13H10BrF6N5O |
| Molecular Weight | 446.15 g/mol |
| Exact Mass | 445.00 |
| IUPAC Name | 2-N-(4-bromophenyl)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(Nc2ccc(Br)cc2)nc(OC(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C13H10BrF6N5O/c1-21-9-23-10(22-7-4-2-6(14)3-5-7)25-11(24-9)26-8(12(15,16)17)13(18,19)20/h2-5,8H,1H3,(H2,21,22,23,24,25) |
| InChIKey | SBMFLHMEPYOCFI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.15 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |