C20H22Br2N2O2S — CID 3112259
7-tert-butyl-2-(3,5-dibromo-2-hydroxyphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 3112259) has the molecular formula C20H22Br2N2O2S and a molecular weight of 514.28 g/mol. Its IUPAC name is 7-tert-butyl-2-(3,5-dibromo-2-hydroxyphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-tert-butyl-2-(3,5-dibromo-2-hydroxyphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3112259 |
| Molecular Formula | C20H22Br2N2O2S |
| Molecular Weight | 514.28 g/mol |
| Exact Mass | 511.98 |
| IUPAC Name | 7-tert-butyl-2-(3,5-dibromo-2-hydroxyphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CC(C)(C)C1CCc2c(sc3c2C(=O)NC(c2cc(Br)cc(Br)c2O)N3)C1 |
| InChI | InChI=1S/C20H22Br2N2O2S/c1-20(2,3)9-4-5-11-14(6-9)27-19-15(11)18(26)23-17(24-19)12-7-10(21)8-13(22)16(12)25/h7-9,17,24-25H,4-6H2,1-3H3,(H,23,26) |
| InChIKey | UPYGXEQPDWITFU-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.28 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|